![1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS: 86215-36-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0736851.png "1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride chemical structure")
1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride
Catalog No: FT-0736851
CAS No: 86215-36-3
- Chemical Name: 1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride
- Molecular Formula: C11H12Cl3N
- Molecular Weight: 264.6
- InChI Key: KAGBHVBIOJBGBD-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11Cl2N.ClH/c12-9-2-1-7(3-10(9)13)11-4-8(11)5-14-6-11;/h1-3,8,14H,4-6H2;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 86215-36-3 |
|---|---|
| MF: | C11H12Cl3N |
| Density: | N/A |
| Flash_Point: | 150ºC |
| Melting_Point: | N/A |
| Product_Name: | 1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane,hydrochloride |
| Symbol: | GHS06 |
| Bolling_Point: | 324.4ºC at 760 mmHg |
| FW: | 264.57900 |
| MF: | C11H12Cl3N |
|---|---|
| LogP: | 3.98510 |
| Exact_Mass: | 263.00400 |
| Bolling_Point: | 324.4ºC at 760 mmHg |
| Flash_Point: | 150ºC |
| FW: | 264.57900 |
| PSA: | 12.03000 |
| Safety_Statements: | H301-H319 |
|---|---|
| Symbol: | GHS06 |
| Warning_Statement: | P301 + P310-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | UN 2811 6.1 / PGIII |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)